Sodium laureth sulfate

آزاد دائرۃ المعارف، ویکیپیڈیا سے
:چھلانگ بطرف رہنمائی، تلاش
Sodium laureth sulfate
Sodium laureth sulfate structure.png
شناختساز
کاس عدد

[009004-82-4]

خـواص
سالماتی_صیغہ

CH3(CH2)10CH2(OCH2CH2)nOSO3Na
C11+nH23+4nNaO4+nS

مولرکمیت

around 420 g/mol
(274.35 + 44.05n) g mol−1

ماسواۓ کسی خصوصی بیان کے، تمام مادی معطیات
معیاری درجہ حرات و دباؤ یعنی 25°C, 100 kPa
پر دیۓ گۓ ہیں۔
لاتعلقیتِ معلوماتی خانہ و حوالہ جات